C14H26O3S — CID 103277387
1-(3,5-dimethylcyclohex-3-en-1-yl)-4-ethylsulfonylbutan-1-ol (PubChem CID 103277387) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 103277387 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C14H26O3S/c1-4-18(16,17)7-5-6-14(15)13-9-11(2)8-12(3)10-13/h8,11,13-15H,4-7,9-10H2,1-3H3 |
| InChIKey | DFQZSZKTQUMELA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|