C14H26O3S3 — CID 46215750
2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]-4-methylsulfonylbutan-1-ol (PubChem CID 46215750) has the molecular formula C14H26O3S3 and a molecular weight of 338.56 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]-4-methylsulfonylbutan-1-ol.
| Compound Name | 2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 46215750 |
| Molecular Formula | C14H26O3S3 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]-4-methylsulfonylbutan-1-ol |
| SMILES | CC(C)=CC1(C(O)C(C)CCS(C)(=O)=O)SCCCS1 |
| InChI | InChI=1S/C14H26O3S3/c1-11(2)10-14(18-7-5-8-19-14)13(15)12(3)6-9-20(4,16)17/h10,12-13,15H,5-9H2,1-4H3 |
| InChIKey | RKFMXBXBKYTHTK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|