C28H39FN3O3P — CID 163494089
1-tert-butyl-4-(4-fluoro-2-phosphanylphenyl)-N-[4-(4-hydroxyphenyl)-4-(propanoylamino)butyl]pyrrolidine-3-carboxamide (PubChem CID 163494089) has the molecular formula C28H39FN3O3P and a molecular weight of 515.61 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-fluoro-2-phosphanylphenyl)-N-[4-(4-hydroxyphenyl)-4-(propanoylamino)butyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-4-(4-fluoro-2-phosphanylphenyl)-N-[4-(4-hydroxyphenyl)-4-(propanoylamino)butyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163494089 |
| Molecular Formula | C28H39FN3O3P |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 1-tert-butyl-4-(4-fluoro-2-phosphanylphenyl)-N-[4-(4-hydroxyphenyl)-4-(propanoylamino)butyl]pyrrolidine-3-carboxamide |
| SMILES | CCC(=O)NC(CCCNC(=O)C1CN(C(C)(C)C)CC1c1ccc(F)cc1P)c1ccc(O)cc1 |
| InChI | InChI=1S/C28H39FN3O3P/c1-5-26(34)31-24(18-8-11-20(33)12-9-18)7-6-14-30-27(35)23-17-32(28(2,3)4)16-22(23)21-13-10-19(29)15-25(21)36/h8-13,15,22-24,33H,5-7,14,16-17,36H2,1-4H3,(H,30,35)(H,31,34) |
| InChIKey | CPERXTDNSNHFDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|