C10H19N — CID 163494858
N,6-dimethyl-5-methylidenehept-6-en-3-amine (PubChem CID 163494858) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is N,6-dimethyl-5-methylidenehept-6-en-3-amine.
| Compound Name | N,6-dimethyl-5-methylidenehept-6-en-3-amine |
|---|---|
| PubChem CID | 163494858 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N,6-dimethyl-5-methylidenehept-6-en-3-amine |
| SMILES | C=C(C)C(=C)CC(CC)NC |
| InChI | InChI=1S/C10H19N/c1-6-10(11-5)7-9(4)8(2)3/h10-11H,2,4,6-7H2,1,3,5H3 |
| InChIKey | CPUZWCHJEGRMIX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|