C12H22N2O3 — CID 59438924
N-(1,5-dioxohexan-3-yl)-3-(methylamino)pentanamide (PubChem CID 59438924) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(1,5-dioxohexan-3-yl)-3-(methylamino)pentanamide.
| Compound Name | N-(1,5-dioxohexan-3-yl)-3-(methylamino)pentanamide |
|---|---|
| PubChem CID | 59438924 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-(1,5-dioxohexan-3-yl)-3-(methylamino)pentanamide |
| SMILES | CCC(CC(=O)NC(CC=O)CC(C)=O)NC |
| InChI | InChI=1S/C12H22N2O3/c1-4-10(13-3)8-12(17)14-11(5-6-15)7-9(2)16/h6,10-11,13H,4-5,7-8H2,1-3H3,(H,14,17) |
| InChIKey | CWISPRRWUHYJSE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|