C15H29NO2 — CID 170597956
3-methyl-N-(1-oxohexan-3-yl)octanamide (PubChem CID 170597956) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-methyl-N-(1-oxohexan-3-yl)octanamide.
| Compound Name | 3-methyl-N-(1-oxohexan-3-yl)octanamide |
|---|---|
| PubChem CID | 170597956 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3-methyl-N-(1-oxohexan-3-yl)octanamide |
| SMILES | CCCCCC(C)CC(=O)NC(CC=O)CCC |
| InChI | InChI=1S/C15H29NO2/c1-4-6-7-9-13(3)12-15(18)16-14(8-5-2)10-11-17/h11,13-14H,4-10,12H2,1-3H3,(H,16,18) |
| InChIKey | KJMRKSTXKCYVAG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|