C21H43NO2 — CID 88590856
(3R)-N-[(2R)-1-hydroxyhexan-2-yl]-3-methyltetradecanamide (PubChem CID 88590856) has the molecular formula C21H43NO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is (3R)-N-[(2R)-1-hydroxyhexan-2-yl]-3-methyltetradecanamide.
| Compound Name | (3R)-N-[(2R)-1-hydroxyhexan-2-yl]-3-methyltetradecanamide |
|---|---|
| PubChem CID | 88590856 |
| Molecular Formula | C21H43NO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.33 |
| IUPAC Name | (3R)-N-[(2R)-1-hydroxyhexan-2-yl]-3-methyltetradecanamide |
| SMILES | CCCCCCCCCCC[C@@H](C)CC(=O)N[C@@H](CO)CCCC |
| InChI | InChI=1S/C21H43NO2/c1-4-6-8-9-10-11-12-13-14-15-19(3)17-21(24)22-20(18-23)16-7-5-2/h19-20,23H,4-18H2,1-3H3,(H,22,24)/t19-,20-/m1/s1 |
| InChIKey | HJNFHFOUZJNVBI-WOJBJXKFSA-N |
| XLogP | 5.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|