C24H45N3O4 — CID 170598047
N-[1-(2,7-dioxooctan-4-ylamino)-7-(methylamino)-1-oxoheptan-3-yl]-3-methylheptanamide (PubChem CID 170598047) has the molecular formula C24H45N3O4 and a molecular weight of 439.64 g/mol. Its IUPAC name is N-[1-(2,7-dioxooctan-4-ylamino)-7-(methylamino)-1-oxoheptan-3-yl]-3-methylheptanamide.
| Compound Name | N-[1-(2,7-dioxooctan-4-ylamino)-7-(methylamino)-1-oxoheptan-3-yl]-3-methylheptanamide |
|---|---|
| PubChem CID | 170598047 |
| Molecular Formula | C24H45N3O4 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.34 |
| IUPAC Name | N-[1-(2,7-dioxooctan-4-ylamino)-7-(methylamino)-1-oxoheptan-3-yl]-3-methylheptanamide |
| SMILES | CCCCC(C)CC(=O)NC(CCCCNC)CC(=O)NC(CCC(C)=O)CC(C)=O |
| InChI | InChI=1S/C24H45N3O4/c1-6-7-10-18(2)15-23(30)26-21(11-8-9-14-25-5)17-24(31)27-22(16-20(4)29)13-12-19(3)28/h18,21-22,25H,6-17H2,1-5H3,(H,26,30)(H,27,31) |
| InChIKey | PXRPNAOJYQSICM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|