C35H65MnN4O5- — CID 170598024
N-[6-(2,7-dioxotridecan-4-ylamino)-4-[[3-methyl-6-(methylamino)hexanoyl]amino]-6-oxohexyl]-3-methylheptanamide;manganese (PubChem CID 170598024) has the molecular formula C35H65MnN4O5- and a molecular weight of 676.87 g/mol. Its IUPAC name is N-[6-(2,7-dioxotridecan-4-ylamino)-4-[[3-methyl-6-(methylamino)hexanoyl]amino]-6-oxohexyl]-3-methylheptanamide;manganese.
| Compound Name | N-[6-(2,7-dioxotridecan-4-ylamino)-4-[[3-methyl-6-(methylamino)hexanoyl]amino]-6-oxohexyl]-3-methylheptanamide;manganese |
|---|---|
| PubChem CID | 170598024 |
| Molecular Formula | C35H65MnN4O5- |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.43 |
| IUPAC Name | N-[6-(2,7-dioxotridecan-4-ylamino)-4-[[3-methyl-6-(methylamino)hexanoyl]amino]-6-oxohexyl]-3-methylheptanamide;manganese |
| SMILES | CCCC[CH-]CC(=O)CCC(CC(C)=O)NC(=O)CC(CCCNC(=O)CC(C)CCCC)NC(=O)CC(C)CCCNC.[Mn] |
| InChI | InChI=1S/C35H65N4O5.Mn/c1-7-9-11-12-18-32(41)20-19-31(25-29(5)40)39-35(44)26-30(38-34(43)24-28(4)16-13-21-36-6)17-14-22-37-33(42)23-27(3)15-10-8-2;/h12,27-28,30-31,36H,7-11,13-26H2,1-6H3,(H,37,42)(H,38,43)(H,39,44);/q-1; |
| InChIKey | FTHLRMOFDIWSFO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|