C27H48N4O6 — CID 170598084
3-methyl-N-[1-[[8-[3-(methylamino)pentanoylamino]-2-oxooctan-4-yl]amino]-1,5-dioxohexan-3-yl]-5-oxohexanamide (PubChem CID 170598084) has the molecular formula C27H48N4O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is 3-methyl-N-[1-[[8-[3-(methylamino)pentanoylamino]-2-oxooctan-4-yl]amino]-1,5-dioxohexan-3-yl]-5-oxohexanamide.
| Compound Name | 3-methyl-N-[1-[[8-[3-(methylamino)pentanoylamino]-2-oxooctan-4-yl]amino]-1,5-dioxohexan-3-yl]-5-oxohexanamide |
|---|---|
| PubChem CID | 170598084 |
| Molecular Formula | C27H48N4O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | 3-methyl-N-[1-[[8-[3-(methylamino)pentanoylamino]-2-oxooctan-4-yl]amino]-1,5-dioxohexan-3-yl]-5-oxohexanamide |
| SMILES | CCC(CC(=O)NCCCCC(CC(C)=O)NC(=O)CC(CC(C)=O)NC(=O)CC(C)CC(C)=O)NC |
| InChI | InChI=1S/C27H48N4O6/c1-7-22(28-6)16-25(35)29-11-9-8-10-23(14-20(4)33)30-27(37)17-24(15-21(5)34)31-26(36)13-18(2)12-19(3)32/h18,22-24,28H,7-17H2,1-6H3,(H,29,35)(H,30,37)(H,31,36) |
| InChIKey | MOBRWDFWIBBOKF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|