C37H76N10O5 — CID 170415685
N-[4-[3,6-bis[3,6-bis(methylamino)hexanoylamino]hexanoylamino]-6-oxoheptyl]-3,6-bis(methylamino)hexanamide (PubChem CID 170415685) has the molecular formula C37H76N10O5 and a molecular weight of 741.08 g/mol. Its IUPAC name is N-[4-[3,6-bis[3,6-bis(methylamino)hexanoylamino]hexanoylamino]-6-oxoheptyl]-3,6-bis(methylamino)hexanamide.
| Compound Name | N-[4-[3,6-bis[3,6-bis(methylamino)hexanoylamino]hexanoylamino]-6-oxoheptyl]-3,6-bis(methylamino)hexanamide |
|---|---|
| PubChem CID | 170415685 |
| Molecular Formula | C37H76N10O5 |
| Molecular Weight | 741.08 g/mol |
| Exact Mass | 740.60 |
| IUPAC Name | N-[4-[3,6-bis[3,6-bis(methylamino)hexanoylamino]hexanoylamino]-6-oxoheptyl]-3,6-bis(methylamino)hexanamide |
| SMILES | CNCCCC(CC(=O)NCCCC(CC(C)=O)NC(=O)CC(CCCNC(=O)CC(CCCNC)NC)NC(=O)CC(CCCNC)NC)NC |
| InChI | InChI=1S/C37H76N10O5/c1-28(48)23-32(16-11-21-44-34(49)24-29(41-5)13-8-18-38-2)46-37(52)27-33(47-36(51)26-31(43-7)15-10-20-40-4)17-12-22-45-35(50)25-30(42-6)14-9-19-39-3/h29-33,38-43H,8-27H2,1-7H3,(H,44,49)(H,45,50)(H,46,52)(H,47,51) |
| InChIKey | DQFAZOSZETXOJM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 205.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.08 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|