C29H53N5O7 — CID 170597961
N-[5-[(2-formamido-5-oxohexanoyl)amino]-7-oxooctyl]-2-(methylamino)-5-oxohexanamide;5-(methylamino)hexan-2-one (PubChem CID 170597961) has the molecular formula C29H53N5O7 and a molecular weight of 583.77 g/mol. Its IUPAC name is N-[5-[(2-formamido-5-oxohexanoyl)amino]-7-oxooctyl]-2-(methylamino)-5-oxohexanamide;5-(methylamino)hexan-2-one.
| Compound Name | N-[5-[(2-formamido-5-oxohexanoyl)amino]-7-oxooctyl]-2-(methylamino)-5-oxohexanamide;5-(methylamino)hexan-2-one |
|---|---|
| PubChem CID | 170597961 |
| Molecular Formula | C29H53N5O7 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.39 |
| IUPAC Name | N-[5-[(2-formamido-5-oxohexanoyl)amino]-7-oxooctyl]-2-(methylamino)-5-oxohexanamide;5-(methylamino)hexan-2-one |
| SMILES | CNC(C)CCC(C)=O.CNC(CCC(C)=O)C(=O)NCCCCC(CC(C)=O)NC(=O)C(CCC(C)=O)NC=O |
| InChI | InChI=1S/C22H38N4O6.C7H15NO/c1-15(28)8-10-19(23-4)21(31)24-12-6-5-7-18(13-17(3)30)26-22(32)20(25-14-27)11-9-16(2)29;1-6(8-3)4-5-7(2)9/h14,18-20,23H,5-13H2,1-4H3,(H,24,31)(H,25,27)(H,26,32);6,8H,4-5H2,1-3H3 |
| InChIKey | BYHXQNPWUMIEDI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 179.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|