C23H45N3O5 — CID 170598079
ethane;formaldehyde;2-methyl-N-[5-[2-(methylamino)pentanoylamino]-7-oxoheptyl]-5-oxohexanamide (PubChem CID 170598079) has the molecular formula C23H45N3O5 and a molecular weight of 443.63 g/mol. Its IUPAC name is ethane;formaldehyde;2-methyl-N-[5-[2-(methylamino)pentanoylamino]-7-oxoheptyl]-5-oxohexanamide.
| Compound Name | ethane;formaldehyde;2-methyl-N-[5-[2-(methylamino)pentanoylamino]-7-oxoheptyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 170598079 |
| Molecular Formula | C23H45N3O5 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | ethane;formaldehyde;2-methyl-N-[5-[2-(methylamino)pentanoylamino]-7-oxoheptyl]-5-oxohexanamide |
| SMILES | C=O.CC.CCCC(NC)C(=O)NC(CC=O)CCCCNC(=O)C(C)CCC(C)=O |
| InChI | InChI=1S/C20H37N3O4.C2H6.CH2O/c1-5-8-18(21-4)20(27)23-17(12-14-24)9-6-7-13-22-19(26)15(2)10-11-16(3)25;2*1-2/h14-15,17-18,21H,5-13H2,1-4H3,(H,22,26)(H,23,27);1-2H3;1H2 |
| InChIKey | KZMRVYMYTQOJDU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|