C26H43N3O7 — CID 170391599
2-methyl-N-[4-[[2-[(2-methyl-5-oxohexanoyl)amino]-5-oxohexanoyl]amino]-6-oxohexyl]-5-oxohexanamide (PubChem CID 170391599) has the molecular formula C26H43N3O7 and a molecular weight of 509.64 g/mol. Its IUPAC name is 2-methyl-N-[4-[[2-[(2-methyl-5-oxohexanoyl)amino]-5-oxohexanoyl]amino]-6-oxohexyl]-5-oxohexanamide.
| Compound Name | 2-methyl-N-[4-[[2-[(2-methyl-5-oxohexanoyl)amino]-5-oxohexanoyl]amino]-6-oxohexyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 170391599 |
| Molecular Formula | C26H43N3O7 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 2-methyl-N-[4-[[2-[(2-methyl-5-oxohexanoyl)amino]-5-oxohexanoyl]amino]-6-oxohexyl]-5-oxohexanamide |
| SMILES | CC(=O)CCC(C)C(=O)NCCCC(CC=O)NC(=O)C(CCC(C)=O)NC(=O)C(C)CCC(C)=O |
| InChI | InChI=1S/C26H43N3O7/c1-17(8-10-19(3)31)24(34)27-15-6-7-22(14-16-30)28-26(36)23(13-12-21(5)33)29-25(35)18(2)9-11-20(4)32/h16-18,22-23H,6-15H2,1-5H3,(H,27,34)(H,28,36)(H,29,35) |
| InChIKey | OGYSZDQUAFWBHT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|