C23H45N3O4 — CID 170598036
N-(2,7-dioxooctan-4-yl)-2-formamidoheptanamide;N-methylhexan-2-amine (PubChem CID 170598036) has the molecular formula C23H45N3O4 and a molecular weight of 427.63 g/mol. Its IUPAC name is N-(2,7-dioxooctan-4-yl)-2-formamidoheptanamide;N-methylhexan-2-amine.
| Compound Name | N-(2,7-dioxooctan-4-yl)-2-formamidoheptanamide;N-methylhexan-2-amine |
|---|---|
| PubChem CID | 170598036 |
| Molecular Formula | C23H45N3O4 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | N-(2,7-dioxooctan-4-yl)-2-formamidoheptanamide;N-methylhexan-2-amine |
| SMILES | CCCCC(C)NC.CCCCCC(NC=O)C(=O)NC(CCC(C)=O)CC(C)=O |
| InChI | InChI=1S/C16H28N2O4.C7H17N/c1-4-5-6-7-15(17-11-19)16(22)18-14(10-13(3)21)9-8-12(2)20;1-4-5-6-7(2)8-3/h11,14-15H,4-10H2,1-3H3,(H,17,19)(H,18,22);7-8H,4-6H2,1-3H3 |
| InChIKey | IXSMAPZSOSHVJL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|