C42H80N4O5 — CID 170391705
3-methyl-N-[1-oxo-1-[[1-oxo-1-[[1-oxo-1-(2-oxononan-4-ylamino)octan-3-yl]amino]octan-3-yl]amino]octan-3-yl]octanamide (PubChem CID 170391705) has the molecular formula C42H80N4O5 and a molecular weight of 721.12 g/mol. Its IUPAC name is 3-methyl-N-[1-oxo-1-[[1-oxo-1-[[1-oxo-1-(2-oxononan-4-ylamino)octan-3-yl]amino]octan-3-yl]amino]octan-3-yl]octanamide.
| Compound Name | 3-methyl-N-[1-oxo-1-[[1-oxo-1-[[1-oxo-1-(2-oxononan-4-ylamino)octan-3-yl]amino]octan-3-yl]amino]octan-3-yl]octanamide |
|---|---|
| PubChem CID | 170391705 |
| Molecular Formula | C42H80N4O5 |
| Molecular Weight | 721.12 g/mol |
| Exact Mass | 720.61 |
| IUPAC Name | 3-methyl-N-[1-oxo-1-[[1-oxo-1-[[1-oxo-1-(2-oxononan-4-ylamino)octan-3-yl]amino]octan-3-yl]amino]octan-3-yl]octanamide |
| SMILES | CCCCCC(C)CC(=O)NC(CCCCC)CC(=O)NC(CCCCC)CC(=O)NC(CCCCC)CC(=O)NC(CCCCC)CC(C)=O |
| InChI | InChI=1S/C42H80N4O5/c1-8-13-18-23-33(6)28-39(48)44-36(25-20-15-10-3)30-41(50)46-38(27-22-17-12-5)32-42(51)45-37(26-21-16-11-4)31-40(49)43-35(29-34(7)47)24-19-14-9-2/h33,35-38H,8-32H2,1-7H3,(H,43,49)(H,44,48)(H,45,51)(H,46,50) |
| InChIKey | SLJVXJXLIDKZCX-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.12 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|