C24H48N12O4 — CID 59074650
(3S)-6-(diaminomethylideneamino)-N-[(3S)-6-(diaminomethylideneamino)-1-[[(3S)-6-(diaminomethylideneamino)-1-oxohexan-3-yl]amino]-1-oxohexan-3-yl]-3-(propanoylamino)hexanamide (PubChem CID 59074650) has the molecular formula C24H48N12O4 and a molecular weight of 568.73 g/mol. Its IUPAC name is (3S)-6-(diaminomethylideneamino)-N-[(3S)-6-(diaminomethylideneamino)-1-[[(3S)-6-(diaminomethylideneamino)-1-oxohexan-3-yl]amino]-1-oxohexan-3-yl]-3-(propanoylamino)hexanamide.
| Compound Name | (3S)-6-(diaminomethylideneamino)-N-[(3S)-6-(diaminomethylideneamino)-1-[[(3S)-6-(diaminomethylideneamino)-1-oxohexan-3-yl]amino]-1-oxohexan-3-yl]-3-(propanoylamino)hexanamide |
|---|---|
| PubChem CID | 59074650 |
| Molecular Formula | C24H48N12O4 |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.39 |
| IUPAC Name | (3S)-6-(diaminomethylideneamino)-N-[(3S)-6-(diaminomethylideneamino)-1-[[(3S)-6-(diaminomethylideneamino)-1-oxohexan-3-yl]amino]-1-oxohexan-3-yl]-3-(propanoylamino)hexanamide |
| SMILES | CCC(=O)N[C@@H](CCCN=C(N)N)CC(=O)N[C@@H](CCCN=C(N)N)CC(=O)N[C@H](CC=O)CCCN=C(N)N |
| InChI | InChI=1S/C24H48N12O4/c1-2-19(38)35-17(7-4-11-32-23(27)28)14-21(40)36-18(8-5-12-33-24(29)30)15-20(39)34-16(9-13-37)6-3-10-31-22(25)26/h13,16-18H,2-12,14-15H2,1H3,(H,34,39)(H,35,38)(H,36,40)(H4,25,26,31)(H4,27,28,32)(H4,29,30,33)/t16-,17-,18-/m0/s1 |
| InChIKey | FASJNTKCHXQPSA-BZSNNMDCSA-N |
| XLogP | -2.62 |
| TPSA | 297.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|