C24H48N10O4 — CID 20810110
6-(diaminomethylideneamino)-N-[6-(diaminomethylideneamino)-1-oxohexan-3-yl]-3-[[4-methyl-3-[3-(methylamino)propanoylamino]pentanoyl]amino]hexanamide (PubChem CID 20810110) has the molecular formula C24H48N10O4 and a molecular weight of 540.71 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)-N-[6-(diaminomethylideneamino)-1-oxohexan-3-yl]-3-[[4-methyl-3-[3-(methylamino)propanoylamino]pentanoyl]amino]hexanamide.
| Compound Name | 6-(diaminomethylideneamino)-N-[6-(diaminomethylideneamino)-1-oxohexan-3-yl]-3-[[4-methyl-3-[3-(methylamino)propanoylamino]pentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 20810110 |
| Molecular Formula | C24H48N10O4 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 6-(diaminomethylideneamino)-N-[6-(diaminomethylideneamino)-1-oxohexan-3-yl]-3-[[4-methyl-3-[3-(methylamino)propanoylamino]pentanoyl]amino]hexanamide |
| SMILES | CNCCC(=O)NC(CC(=O)NC(CCCN=C(N)N)CC(=O)NC(CC=O)CCCN=C(N)N)C(C)C |
| InChI | InChI=1S/C24H48N10O4/c1-16(2)19(34-20(36)8-12-29-3)15-22(38)33-18(7-5-11-31-24(27)28)14-21(37)32-17(9-13-35)6-4-10-30-23(25)26/h13,16-19,29H,4-12,14-15H2,1-3H3,(H,32,37)(H,33,38)(H,34,36)(H4,25,26,30)(H4,27,28,31) |
| InChIKey | OVQQWDHMQJTJKO-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 245.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|