C16H29N7O2 — CID 123453956
N-[1-amino-3-(4-hydroxyphenyl)propan-2-yl]-6-(diaminomethylideneamino)-3-hydrazinylhexanamide (PubChem CID 123453956) has the molecular formula C16H29N7O2 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-[1-amino-3-(4-hydroxyphenyl)propan-2-yl]-6-(diaminomethylideneamino)-3-hydrazinylhexanamide.
| Compound Name | N-[1-amino-3-(4-hydroxyphenyl)propan-2-yl]-6-(diaminomethylideneamino)-3-hydrazinylhexanamide |
|---|---|
| PubChem CID | 123453956 |
| Molecular Formula | C16H29N7O2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-[1-amino-3-(4-hydroxyphenyl)propan-2-yl]-6-(diaminomethylideneamino)-3-hydrazinylhexanamide |
| SMILES | NCC(Cc1ccc(O)cc1)NC(=O)CC(CCCN=C(N)N)NN |
| InChI | InChI=1S/C16H29N7O2/c17-10-13(8-11-3-5-14(24)6-4-11)22-15(25)9-12(23-20)2-1-7-21-16(18)19/h3-6,12-13,23-24H,1-2,7-10,17,20H2,(H,22,25)(H4,18,19,21) |
| InChIKey | MAPWNNYAXRSOGB-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|