C11H20O2 — CID 163495320
4-ethyl-1,3-dimethoxy-6-methylcyclohexene (PubChem CID 163495320) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-ethyl-1,3-dimethoxy-6-methylcyclohexene.
| Compound Name | 4-ethyl-1,3-dimethoxy-6-methylcyclohexene |
|---|---|
| PubChem CID | 163495320 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4-ethyl-1,3-dimethoxy-6-methylcyclohexene |
| SMILES | CCC1CC(C)C(OC)=CC1OC |
| InChI | InChI=1S/C11H20O2/c1-5-9-6-8(2)10(12-3)7-11(9)13-4/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | CQEOXJMMZMKKEM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |