C15H26O4 — CID 145001992
1,2,3-trimethoxy-3-propan-2-yloxy-5-prop-2-enylcyclohexene (PubChem CID 145001992) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,2,3-trimethoxy-3-propan-2-yloxy-5-prop-2-enylcyclohexene.
| Compound Name | 1,2,3-trimethoxy-3-propan-2-yloxy-5-prop-2-enylcyclohexene |
|---|---|
| PubChem CID | 145001992 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1,2,3-trimethoxy-3-propan-2-yloxy-5-prop-2-enylcyclohexene |
| SMILES | C=CCC1CC(OC)=C(OC)C(OC)(OC(C)C)C1 |
| InChI | InChI=1S/C15H26O4/c1-7-8-12-9-13(16-4)14(17-5)15(10-12,18-6)19-11(2)3/h7,11-12H,1,8-10H2,2-6H3 |
| InChIKey | ICOQYDWIGKFAGO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|