C26H44O4 — CID 145001951
1,2,3,3-tetramethoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexene (PubChem CID 145001951) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is 1,2,3,3-tetramethoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexene.
| Compound Name | 1,2,3,3-tetramethoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexene |
|---|---|
| PubChem CID | 145001951 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | 1,2,3,3-tetramethoxy-4-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexene |
| SMILES | COC1=C(OC)C(OC)(OC)C(C)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C26H44O4/c1-19(2)12-10-13-20(3)14-11-15-21(4)16-17-23-18-24(27-6)25(28-7)26(29-8,30-9)22(23)5/h12,14,16,22-23H,10-11,13,15,17-18H2,1-9H3/b20-14+,21-16+ |
| InChIKey | JVZSTNYGWYSTJV-QUFKBVBHSA-N |
| XLogP | 6.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|