C25H42O4 — CID 145002011
3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol (PubChem CID 145002011) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol.
| Compound Name | 3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 145002011 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
| SMILES | COC1=CC(O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C1(OC)OC |
| InChI | InChI=1S/C25H42O4/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-22-21(5)25(28-7,29-8)24(27-6)17-23(22)26/h11,13,15,17,21-23,26H,9-10,12,14,16H2,1-8H3/b19-13+,20-15+ |
| InChIKey | BKZXRFWQXXMGCM-YLYRKCBPSA-N |
| XLogP | 5.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|