C29H50O4 — CID 138465705
5-[(2E,7E)-3,5,5,8,10,10,13-heptamethyltetradeca-2,7,12-trienyl]-3-methoxy-6-methylcyclohex-2-ene-1,2,4-triol (PubChem CID 138465705) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is 5-[(2E,7E)-3,5,5,8,10,10,13-heptamethyltetradeca-2,7,12-trienyl]-3-methoxy-6-methylcyclohex-2-ene-1,2,4-triol.
| Compound Name | 5-[(2E,7E)-3,5,5,8,10,10,13-heptamethyltetradeca-2,7,12-trienyl]-3-methoxy-6-methylcyclohex-2-ene-1,2,4-triol |
|---|---|
| PubChem CID | 138465705 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | 5-[(2E,7E)-3,5,5,8,10,10,13-heptamethyltetradeca-2,7,12-trienyl]-3-methoxy-6-methylcyclohex-2-ene-1,2,4-triol |
| SMILES | COC1=C(O)C(O)C(C)C(C/C=C(\C)CC(C)(C)C/C=C(\C)CC(C)(C)CC=C(C)C)C1O |
| InChI | InChI=1S/C29H50O4/c1-19(2)13-15-28(6,7)18-21(4)14-16-29(8,9)17-20(3)11-12-23-22(5)24(30)26(32)27(33-10)25(23)31/h11,13-14,22-25,30-32H,12,15-18H2,1-10H3/b20-11+,21-14+ |
| InChIKey | VTSFOYLVZYEQOV-FENOTYGDSA-N |
| XLogP | 7.25 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|