C16H28O4 — CID 118674713
1,2,3,3-tetramethoxy-4-methyl-5-(3-methylbut-2-enyl)cyclohexene (PubChem CID 118674713) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,2,3,3-tetramethoxy-4-methyl-5-(3-methylbut-2-enyl)cyclohexene.
| Compound Name | 1,2,3,3-tetramethoxy-4-methyl-5-(3-methylbut-2-enyl)cyclohexene |
|---|---|
| PubChem CID | 118674713 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1,2,3,3-tetramethoxy-4-methyl-5-(3-methylbut-2-enyl)cyclohexene |
| SMILES | COC1=C(OC)C(OC)(OC)C(C)C(CC=C(C)C)C1 |
| InChI | InChI=1S/C16H28O4/c1-11(2)8-9-13-10-14(17-4)15(18-5)16(19-6,20-7)12(13)3/h8,12-13H,9-10H2,1-7H3 |
| InChIKey | JCINBTSYNZPKDS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|