C10H20O2 — CID 163495492
1,1-dimethyl-3-(methylperoxymethyl)cyclohexane (PubChem CID 163495492) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1,1-dimethyl-3-(methylperoxymethyl)cyclohexane.
| Compound Name | 1,1-dimethyl-3-(methylperoxymethyl)cyclohexane |
|---|---|
| PubChem CID | 163495492 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 1,1-dimethyl-3-(methylperoxymethyl)cyclohexane |
| SMILES | COOCC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C10H20O2/c1-10(2)6-4-5-9(7-10)8-12-11-3/h9H,4-8H2,1-3H3 |
| InChIKey | CQICHLZRJPKFPH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|