C8H15O3S- — CID 123585539
(3,3-dimethylcyclopentyl)methyl sulfite (PubChem CID 123585539) has the molecular formula C8H15O3S- and a molecular weight of 191.27 g/mol. Its IUPAC name is (3,3-dimethylcyclopentyl)methyl sulfite.
| Compound Name | (3,3-dimethylcyclopentyl)methyl sulfite |
|---|---|
| PubChem CID | 123585539 |
| Molecular Formula | C8H15O3S- |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (3,3-dimethylcyclopentyl)methyl sulfite |
| SMILES | CC1(C)CCC(COS(=O)[O-])C1 |
| InChI | InChI=1S/C8H16O3S/c1-8(2)4-3-7(5-8)6-11-12(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | UOOCCIPXOZTNMP-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|