C28H61ClO2Si2 — CID 159548386
tert-butyl-chloro-dimethylsilane;tert-butyl-[(3,3-dimethylcyclopentyl)methoxy]-dimethylsilane;(3,3-dimethylcyclopentyl)methanol (PubChem CID 159548386) has the molecular formula C28H61ClO2Si2 and a molecular weight of 521.42 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;tert-butyl-[(3,3-dimethylcyclopentyl)methoxy]-dimethylsilane;(3,3-dimethylcyclopentyl)methanol.
| Compound Name | tert-butyl-chloro-dimethylsilane;tert-butyl-[(3,3-dimethylcyclopentyl)methoxy]-dimethylsilane;(3,3-dimethylcyclopentyl)methanol |
|---|---|
| PubChem CID | 159548386 |
| Molecular Formula | C28H61ClO2Si2 |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;tert-butyl-[(3,3-dimethylcyclopentyl)methoxy]-dimethylsilane;(3,3-dimethylcyclopentyl)methanol |
| SMILES | CC(C)(C)[Si](C)(C)Cl.CC1(C)CCC(CO)C1.CC1(C)CCC(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H30OSi.C8H16O.C6H15ClSi/c1-13(2,3)16(6,7)15-11-12-8-9-14(4,5)10-12;1-8(2)4-3-7(5-8)6-9;1-6(2,3)8(4,5)7/h12H,8-11H2,1-7H3;7,9H,3-6H2,1-2H3;1-5H3 |
| InChIKey | MFBUREGEFCXXKJ-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|