C26H26N4O5 — CID 163497718
3-[1-methyl-5-[(4-methylphenyl)methyl]-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]propyl formate (PubChem CID 163497718) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[1-methyl-5-[(4-methylphenyl)methyl]-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]propyl formate.
| Compound Name | 3-[1-methyl-5-[(4-methylphenyl)methyl]-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]propyl formate |
|---|---|
| PubChem CID | 163497718 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[1-methyl-5-[(4-methylphenyl)methyl]-6-[(6-methyl-3-pyridinyl)oxy]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]propyl formate |
| SMILES | Cc1ccc(Cc2c(Oc3ccc(C)nc3)cnc3c2c(=O)n(CCCOC=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C26H26N4O5/c1-17-5-8-19(9-6-17)13-21-22(35-20-10-7-18(2)27-14-20)15-28-24-23(21)25(32)30(26(33)29(24)3)11-4-12-34-16-31/h5-10,14-16H,4,11-13H2,1-3H3 |
| InChIKey | CSDARIZNTALVGD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|