C14H25NO4 — CID 163498618
methyl N-[1-[4-[hydroxy(methoxy)methyl]-1-bicyclo[2.2.2]octanyl]ethyl]carbamate (PubChem CID 163498618) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl N-[1-[4-[hydroxy(methoxy)methyl]-1-bicyclo[2.2.2]octanyl]ethyl]carbamate.
| Compound Name | methyl N-[1-[4-[hydroxy(methoxy)methyl]-1-bicyclo[2.2.2]octanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 163498618 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | methyl N-[1-[4-[hydroxy(methoxy)methyl]-1-bicyclo[2.2.2]octanyl]ethyl]carbamate |
| SMILES | COC(=O)NC(C)C12CCC(C(O)OC)(CC1)CC2 |
| InChI | InChI=1S/C14H25NO4/c1-10(15-12(17)19-3)13-4-7-14(8-5-13,9-6-13)11(16)18-2/h10-11,16H,4-9H2,1-3H3,(H,15,17) |
| InChIKey | CSVHUXQFJXIFDG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|