C7H13NO2 — CID 163501067
(2Z,4Z)-4-(aminomethyl)hexa-2,4-diene-1,5-diol (PubChem CID 163501067) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2Z,4Z)-4-(aminomethyl)hexa-2,4-diene-1,5-diol.
| Compound Name | (2Z,4Z)-4-(aminomethyl)hexa-2,4-diene-1,5-diol |
|---|---|
| PubChem CID | 163501067 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2Z,4Z)-4-(aminomethyl)hexa-2,4-diene-1,5-diol |
| SMILES | C/C(O)=C(\C=C/CO)CN |
| InChI | InChI=1S/C7H13NO2/c1-6(10)7(5-8)3-2-4-9/h2-3,9-10H,4-5,8H2,1H3/b3-2-,7-6- |
| InChIKey | CUTONVWZCGRWFD-QPHZJVINSA-N |
| XLogP | 0.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|