C29H33F3N2O2 — CID 163506837
(E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(1-fluorocyclohexyl)methyl]-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 163506837) has the molecular formula C29H33F3N2O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(1-fluorocyclohexyl)methyl]-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(1-fluorocyclohexyl)methyl]-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163506837 |
| Molecular Formula | C29H33F3N2O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[(1R,3R)-2-[(1-fluorocyclohexyl)methyl]-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC1C=CC=C2C3=C(NC21)[C@@H](c1c(F)cc(/C=C/C(=O)O)cc1F)N(CC1(F)CCCCC1)[C@H](C)C3 |
| InChI | InChI=1S/C29H33F3N2O2/c1-17-7-6-8-20-21-13-18(2)34(16-29(32)11-4-3-5-12-29)28(27(21)33-26(17)20)25-22(30)14-19(15-23(25)31)9-10-24(35)36/h6-10,14-15,17-18,26,28,33H,3-5,11-13,16H2,1-2H3,(H,35,36)/b10-9+/t17?,18-,26?,28-/m1/s1 |
| InChIKey | CZGWFECNPGQUAU-FCYIIIHVSA-N |
| XLogP | 6.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|