C12H17F2N3 — CID 163509394
2-[4-[(1S)-1-aminoethyl]-3,6-difluorocyclohexa-1,3-dien-1-yl]-3-methyliminoprop-1-en-1-amine (PubChem CID 163509394) has the molecular formula C12H17F2N3 and a molecular weight of 241.28 g/mol. Its IUPAC name is 2-[4-[(1S)-1-aminoethyl]-3,6-difluorocyclohexa-1,3-dien-1-yl]-3-methyliminoprop-1-en-1-amine.
| Compound Name | 2-[4-[(1S)-1-aminoethyl]-3,6-difluorocyclohexa-1,3-dien-1-yl]-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 163509394 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[4-[(1S)-1-aminoethyl]-3,6-difluorocyclohexa-1,3-dien-1-yl]-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C/C(=CN)C1=CC(F)=C([C@H](C)N)CC1F |
| InChI | InChI=1S/C12H17F2N3/c1-7(16)9-3-12(14)10(4-11(9)13)8(5-15)6-17-2/h4-7,12H,3,15-16H2,1-2H3/b8-5?,17-6+/t7-,12?/m0/s1 |
| InChIKey | QINRNMQPRONWOE-GKAHUOGSSA-N |
| XLogP | 1.77 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|