C44H24F6O6S2+2 — CID 163509632
bis[4-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]phenyl] (E)-but-2-enedioate (PubChem CID 163509632) has the molecular formula C44H24F6O6S2+2 and a molecular weight of 826.79 g/mol. Its IUPAC name is bis[4-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]phenyl] (E)-but-2-enedioate.
| Compound Name | bis[4-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]phenyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 163509632 |
| Molecular Formula | C44H24F6O6S2+2 |
| Molecular Weight | 826.79 g/mol |
| Exact Mass | 826.09 |
| IUPAC Name | bis[4-[9-oxo-2-(trifluoromethyl)thioxanthen-10-ium-10-yl]phenyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1ccc(-[s+]2c3ccccc3c(=O)c3cc(C(F)(F)F)ccc32)cc1)Oc1ccc(-[s+]2c3ccccc3c(=O)c3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C44H24F6O6S2/c45-43(46,47)25-9-19-37-33(23-25)41(53)31-5-1-3-7-35(31)57(37)29-15-11-27(12-16-29)55-39(51)21-22-40(52)56-28-13-17-30(18-14-28)58-36-8-4-2-6-32(36)42(54)34-24-26(44(48,49)50)10-20-38(34)58/h1-24H/q+2/b22-21+ |
| InChIKey | DBPFNBUGKOGMCR-QURGRASLSA-N |
| XLogP | 11.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.79 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|