C40H54O8 — CID 163511296
bis[2-[3-(2-ethylcyclobutyl)propoxycarbonyl]-3,4,6-trimethylphenyl] oxalate (PubChem CID 163511296) has the molecular formula C40H54O8 and a molecular weight of 662.86 g/mol. Its IUPAC name is bis[2-[3-(2-ethylcyclobutyl)propoxycarbonyl]-3,4,6-trimethylphenyl] oxalate.
| Compound Name | bis[2-[3-(2-ethylcyclobutyl)propoxycarbonyl]-3,4,6-trimethylphenyl] oxalate |
|---|---|
| PubChem CID | 163511296 |
| Molecular Formula | C40H54O8 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | bis[2-[3-(2-ethylcyclobutyl)propoxycarbonyl]-3,4,6-trimethylphenyl] oxalate |
| SMILES | CCC1CCC1CCCOC(=O)c1c(C)c(C)cc(C)c1OC(=O)C(=O)Oc1c(C)cc(C)c(C)c1C(=O)OCCCC1CCC1CC |
| InChI | InChI=1S/C40H54O8/c1-9-29-15-17-31(29)13-11-19-45-37(41)33-27(7)23(3)21-25(5)35(33)47-39(43)40(44)48-36-26(6)22-24(4)28(8)34(36)38(42)46-20-12-14-32-18-16-30(32)10-2/h21-22,29-32H,9-20H2,1-8H3 |
| InChIKey | DCXQSLZQXKYPMH-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|