C35H49N5O8 — CID 163930723
1-O-[3,6-diamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]-4-methylphenyl] 2-O-[3,4,6-triamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]phenyl] oxalate (PubChem CID 163930723) has the molecular formula C35H49N5O8 and a molecular weight of 667.80 g/mol. Its IUPAC name is 1-O-[3,6-diamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]-4-methylphenyl] 2-O-[3,4,6-triamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]phenyl] oxalate.
| Compound Name | 1-O-[3,6-diamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]-4-methylphenyl] 2-O-[3,4,6-triamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]phenyl] oxalate |
|---|---|
| PubChem CID | 163930723 |
| Molecular Formula | C35H49N5O8 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | 1-O-[3,6-diamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]-4-methylphenyl] 2-O-[3,4,6-triamino-2-[3-(1-ethylcyclopropyl)butoxycarbonyl]phenyl] oxalate |
| SMILES | CCC1(C(C)CCOC(=O)c2c(N)c(C)cc(N)c2OC(=O)C(=O)Oc2c(N)cc(N)c(N)c2C(=O)OCCC(C)C2(CC)CC2)CC1 |
| InChI | InChI=1S/C35H49N5O8/c1-6-34(10-11-34)19(4)8-14-45-30(41)24-26(39)18(3)16-22(37)28(24)47-32(43)33(44)48-29-23(38)17-21(36)27(40)25(29)31(42)46-15-9-20(5)35(7-2)12-13-35/h16-17,19-20H,6-15,36-40H2,1-5H3 |
| InChIKey | RILMQFAKNMANNM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 235.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|