About 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene
10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene (PubChem CID 163511436) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene.
Analyze 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene?
The IUPAC name of 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene (CID 163511436) is 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene.
What is the SMILES notation for 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene?
The canonical SMILES for 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene is CC1CC2CC1C1C3=C(CC21)O3.
What is the InChIKey of 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene?
The InChIKey is DDAPFNKHMYCUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-5-2-6-3-7(5)10-8(6)4-9-11(10)12-9/h5-8,10H,2-4H2,1H3.
What are the key properties of 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene?
10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene has a molecular weight of 162.23 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-4-oxatetracyclo[6.2.1.02,7.03,5]undec-3(5)-ene is sourced from PubChem (CID 163511436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).