(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride

C6H6ClFO2S — CID 163511445

IUPAC(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1=CC[C@H](F)C=C1
InChIInChI=1S/C6H6ClFO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1,3-5H,2H2/t5-/m1/s1
InChIKeyDDAVBKWPJFUDFX-RXMQYKEDSA-N
MW196.63 g/mol
LogP1.74
Rot. Bonds1

About (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride

(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride (PubChem CID 163511445) has the molecular formula C6H6ClFO2S and a molecular weight of 196.63 g/mol. Its IUPAC name is (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride.

Molecular Properties

Compound Name(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride
PubChem CID163511445
Molecular FormulaC6H6ClFO2S
Molecular Weight196.63 g/mol
Exact Mass195.98
IUPAC Name(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1=CC[C@H](F)C=C1
InChIInChI=1S/C6H6ClFO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1,3-5H,2H2/t5-/m1/s1
InChIKeyDDAVBKWPJFUDFX-RXMQYKEDSA-N
XLogP1.74
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.63
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride?
The IUPAC name of (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride (CID 163511445) is (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride.
What is the SMILES notation for (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride?
The canonical SMILES for (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride is O=S(=O)(Cl)C1=CC[C@H](F)C=C1.
What is the InChIKey of (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride?
The InChIKey is DDAVBKWPJFUDFX-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H6ClFO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1,3-5H,2H2/t5-/m1/s1.
What are the key properties of (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride?
(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride has a molecular weight of 196.63 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride is sourced from PubChem (CID 163511445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).