C6H6ClFO2S — CID 163511445
(4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride (PubChem CID 163511445) has the molecular formula C6H6ClFO2S and a molecular weight of 196.63 g/mol. Its IUPAC name is (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride.
| Compound Name | (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 163511445 |
| Molecular Formula | C6H6ClFO2S |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | (4S)-4-fluorocyclohexa-1,5-diene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1=CC[C@H](F)C=C1 |
| InChI | InChI=1S/C6H6ClFO2S/c7-11(9,10)6-3-1-5(8)2-4-6/h1,3-5H,2H2/t5-/m1/s1 |
| InChIKey | DDAVBKWPJFUDFX-RXMQYKEDSA-N |
| XLogP | 1.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |