C22H27ClF3N4O3S+ — CID 163513563
CID 163513563 (PubChem CID 163513563) has the molecular formula C22H27ClF3N4O3S+ and a molecular weight of 520.00 g/mol.
| Compound Name | CID 163513563 |
|---|---|
| PubChem CID | 163513563 |
| Molecular Formula | C22H27ClF3N4O3S+ |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | — |
| SMILES | CC(C)[SH+](=O)N1CCN(c2cnn(-c3cccc(Cl)c3)c(=O)c2OCC2(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H26ClF3N4O3S/c1-15(2)34(32)29-10-8-28(9-11-29)18-13-27-30(17-5-3-4-16(23)12-17)20(31)19(18)33-14-21(6-7-21)22(24,25)26/h3-5,12-13,15H,6-11,14H2,1-2H3/p+1 |
| InChIKey | DETXVAZTNCQRCY-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|