About CID 163513563
CID 163513563 (PubChem CID 163513563) has the molecular formula C22H27ClF3N4O3S+
and a molecular weight of 520.00 g/mol.
Molecular Properties
| Compound Name | CID 163513563 |
| PubChem CID | 163513563 |
| Molecular Formula | C22H27ClF3N4O3S+ |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | — |
| SMILES | CC(C)[SH+](=O)N1CCN(c2cnn(-c3cccc(Cl)c3)c(=O)c2OCC2(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H26ClF3N4O3S/c1-15(2)34(32)29-10-8-28(9-11-29)18-13-27-30(17-5-3-4-16(23)12-17)20(31)19(18)33-14-21(6-7-21)22(24,25)26/h3-5,12-13,15H,6-11,14H2,1-2H3/p+1 |
| InChIKey | DETXVAZTNCQRCY-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 163513563 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163513563?
The IUPAC name of CID 163513563 (CID 163513563) is not available.
What is the SMILES notation for CID 163513563?
The canonical SMILES for CID 163513563 is CC(C)[SH+](=O)N1CCN(c2cnn(-c3cccc(Cl)c3)c(=O)c2OCC2(C(F)(F)F)CC2)CC1.
What is the InChIKey of CID 163513563?
The InChIKey is DETXVAZTNCQRCY-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H26ClF3N4O3S/c1-15(2)34(32)29-10-8-28(9-11-29)18-13-27-30(17-5-3-4-16(23)12-17)20(31)19(18)33-14-21(6-7-21)22(24,25)26/h3-5,12-13,15H,6-11,14H2,1-2H3/p+1.
What are the key properties of CID 163513563?
CID 163513563 has a molecular weight of 520.00 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163513563 is sourced from PubChem (CID 163513563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).