C21H27ClN5O6P — CID 145479018
2-(3-chlorophenyl)-5-[4-[ethoxy(nitro)phosphoryl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one (PubChem CID 145479018) has the molecular formula C21H27ClN5O6P and a molecular weight of 511.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[4-[ethoxy(nitro)phosphoryl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one.
| Compound Name | 2-(3-chlorophenyl)-5-[4-[ethoxy(nitro)phosphoryl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 145479018 |
| Molecular Formula | C21H27ClN5O6P |
| Molecular Weight | 511.90 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[4-[ethoxy(nitro)phosphoryl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one |
| SMILES | CCOP(=O)(N1CCN(c2cnn(-c3cccc(Cl)c3)c(=O)c2OCC2(C)CC2)CC1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H27ClN5O6P/c1-3-33-34(31,27(29)30)25-11-9-24(10-12-25)18-14-23-26(17-6-4-5-16(22)13-17)20(28)19(18)32-15-21(2)7-8-21/h4-6,13-14H,3,7-12,15H2,1-2H3 |
| InChIKey | YTISHBFZIUHYEH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.90 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|