C28H32ClN5O7S — CID 118350859
2-(3-chlorophenyl)-5-[4-[(3,5-dimethoxy-2-nitrophenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one (PubChem CID 118350859) has the molecular formula C28H32ClN5O7S and a molecular weight of 618.11 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[4-[(3,5-dimethoxy-2-nitrophenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one.
| Compound Name | 2-(3-chlorophenyl)-5-[4-[(3,5-dimethoxy-2-nitrophenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 118350859 |
| Molecular Formula | C28H32ClN5O7S |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[4-[(3,5-dimethoxy-2-nitrophenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]pyridazin-3-one |
| SMILES | COc1cc(CS(=O)N2CCN(c3cnn(-c4cccc(Cl)c4)c(=O)c3OCC3(C)CC3)CC2)c([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C28H32ClN5O7S/c1-28(7-8-28)18-41-26-23(16-30-33(27(26)35)21-6-4-5-20(29)14-21)31-9-11-32(12-10-31)42(38)17-19-13-22(39-2)15-24(40-3)25(19)34(36)37/h4-6,13-16H,7-12,17-18H2,1-3H3 |
| InChIKey | CMNUOVYRTCACDY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 129.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|