C26H31N5O4S — CID 118350819
5-[4-[(2-amino-3-hydroxyphenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]-2-phenylpyridazin-3-one (PubChem CID 118350819) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 5-[4-[(2-amino-3-hydroxyphenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]-2-phenylpyridazin-3-one.
| Compound Name | 5-[4-[(2-amino-3-hydroxyphenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 118350819 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 5-[4-[(2-amino-3-hydroxyphenyl)methylsulfinyl]piperazin-1-yl]-4-[(1-methylcyclopropyl)methoxy]-2-phenylpyridazin-3-one |
| SMILES | CC1(COc2c(N3CCN(S(=O)Cc4cccc(O)c4N)CC3)cnn(-c3ccccc3)c2=O)CC1 |
| InChI | InChI=1S/C26H31N5O4S/c1-26(10-11-26)18-35-24-21(16-28-31(25(24)33)20-7-3-2-4-8-20)29-12-14-30(15-13-29)36(34)17-19-6-5-9-22(32)23(19)27/h2-9,16,32H,10-15,17-18,27H2,1H3 |
| InChIKey | GRGQLBZKJWRJGZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|