C28H34N4O2S — CID 118350812
4-[(1-methylcyclopropyl)methoxy]-5-[4-[2-(4-methylphenyl)ethylsulfanyl]piperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 118350812) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is 4-[(1-methylcyclopropyl)methoxy]-5-[4-[2-(4-methylphenyl)ethylsulfanyl]piperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-[(1-methylcyclopropyl)methoxy]-5-[4-[2-(4-methylphenyl)ethylsulfanyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 118350812 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-[(1-methylcyclopropyl)methoxy]-5-[4-[2-(4-methylphenyl)ethylsulfanyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | Cc1ccc(CCSN2CCN(c3cnn(-c4ccccc4)c(=O)c3OCC3(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O2S/c1-22-8-10-23(11-9-22)12-19-35-31-17-15-30(16-18-31)25-20-29-32(24-6-4-3-5-7-24)27(33)26(25)34-21-28(2)13-14-28/h3-11,20H,12-19,21H2,1-2H3 |
| InChIKey | MGADVJMSJDUSGF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|