C27H33N5O2S — CID 118351162
5-[4-[(4-amino-3-methylphenyl)methylsulfanyl]piperazin-1-yl]-4-cyclopentyloxy-2-phenylpyridazin-3-one (PubChem CID 118351162) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is 5-[4-[(4-amino-3-methylphenyl)methylsulfanyl]piperazin-1-yl]-4-cyclopentyloxy-2-phenylpyridazin-3-one.
| Compound Name | 5-[4-[(4-amino-3-methylphenyl)methylsulfanyl]piperazin-1-yl]-4-cyclopentyloxy-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 118351162 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 5-[4-[(4-amino-3-methylphenyl)methylsulfanyl]piperazin-1-yl]-4-cyclopentyloxy-2-phenylpyridazin-3-one |
| SMILES | Cc1cc(CSN2CCN(c3cnn(-c4ccccc4)c(=O)c3OC3CCCC3)CC2)ccc1N |
| InChI | InChI=1S/C27H33N5O2S/c1-20-17-21(11-12-24(20)28)19-35-31-15-13-30(14-16-31)25-18-29-32(22-7-3-2-4-8-22)27(33)26(25)34-23-9-5-6-10-23/h2-4,7-8,11-12,17-18,23H,5-6,9-10,13-16,19,28H2,1H3 |
| InChIKey | KBKKANGFHNLQHF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|