C34H43N5O2 — CID 25014606
4-(1-benzylpiperidin-4-yl)oxy-5-[4-[(4-methylcyclohex-2-en-1-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 25014606) has the molecular formula C34H43N5O2 and a molecular weight of 553.75 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)oxy-5-[4-[(4-methylcyclohex-2-en-1-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-(1-benzylpiperidin-4-yl)oxy-5-[4-[(4-methylcyclohex-2-en-1-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 25014606 |
| Molecular Formula | C34H43N5O2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)oxy-5-[4-[(4-methylcyclohex-2-en-1-yl)methyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | CC1C=CC(CN2CCN(c3cnn(-c4ccccc4)c(=O)c3OC3CCN(Cc4ccccc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C34H43N5O2/c1-27-12-14-29(15-13-27)26-37-20-22-38(23-21-37)32-24-35-39(30-10-6-3-7-11-30)34(40)33(32)41-31-16-18-36(19-17-31)25-28-8-4-2-5-9-28/h2-12,14,24,27,29,31H,13,15-23,25-26H2,1H3 |
| InChIKey | FWBXDLWWBPVZHV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|