C27H34N4O3 — CID 145479481
5-[4-[(2-ethyl-6-methylphenyl)methyl]piperazin-1-yl]-4-(2-methoxyethoxy)-2-phenylpyridazin-3-one (PubChem CID 145479481) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 5-[4-[(2-ethyl-6-methylphenyl)methyl]piperazin-1-yl]-4-(2-methoxyethoxy)-2-phenylpyridazin-3-one.
| Compound Name | 5-[4-[(2-ethyl-6-methylphenyl)methyl]piperazin-1-yl]-4-(2-methoxyethoxy)-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 145479481 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 5-[4-[(2-ethyl-6-methylphenyl)methyl]piperazin-1-yl]-4-(2-methoxyethoxy)-2-phenylpyridazin-3-one |
| SMILES | CCc1cccc(C)c1CN1CCN(c2cnn(-c3ccccc3)c(=O)c2OCCOC)CC1 |
| InChI | InChI=1S/C27H34N4O3/c1-4-22-10-8-9-21(2)24(22)20-29-13-15-30(16-14-29)25-19-28-31(23-11-6-5-7-12-23)27(32)26(25)34-18-17-33-3/h5-12,19H,4,13-18,20H2,1-3H3 |
| InChIKey | JPSIWQRHPURLGQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|