C25H29N5O4S — CID 53318377
4-cyclopentyloxy-2-phenyl-5-[4-(pyridin-3-ylmethylsulfonyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 53318377) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 4-cyclopentyloxy-2-phenyl-5-[4-(pyridin-3-ylmethylsulfonyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-cyclopentyloxy-2-phenyl-5-[4-(pyridin-3-ylmethylsulfonyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 53318377 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-cyclopentyloxy-2-phenyl-5-[4-(pyridin-3-ylmethylsulfonyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(OC2CCCC2)c(N2CCN(S(=O)(=O)Cc3cccnc3)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C25H29N5O4S/c31-25-24(34-22-10-4-5-11-22)23(18-27-30(25)21-8-2-1-3-9-21)28-13-15-29(16-14-28)35(32,33)19-20-7-6-12-26-17-20/h1-3,6-9,12,17-18,22H,4-5,10-11,13-16,19H2 |
| InChIKey | CASIUAKMOOLEBE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |