C29H38N4O7S — CID 54585683
5-(4-benzylsulfonylpiperazin-1-yl)-4,6-bis(2-ethoxyethoxy)-2-phenylpyridazin-3-one (PubChem CID 54585683) has the molecular formula C29H38N4O7S and a molecular weight of 586.71 g/mol. Its IUPAC name is 5-(4-benzylsulfonylpiperazin-1-yl)-4,6-bis(2-ethoxyethoxy)-2-phenylpyridazin-3-one.
| Compound Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4,6-bis(2-ethoxyethoxy)-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 54585683 |
| Molecular Formula | C29H38N4O7S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4,6-bis(2-ethoxyethoxy)-2-phenylpyridazin-3-one |
| SMILES | CCOCCOc1nn(-c2ccccc2)c(=O)c(OCCOCC)c1N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H38N4O7S/c1-3-37-19-21-39-27-26(31-15-17-32(18-16-31)41(35,36)23-24-11-7-5-8-12-24)28(40-22-20-38-4-2)30-33(29(27)34)25-13-9-6-10-14-25/h5-14H,3-4,15-23H2,1-2H3 |
| InChIKey | ZMLDOJZKQYZKTJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|