C25H28FN5O2S — CID 118350924
4-[[1-(fluoromethyl)cyclopropyl]methoxy]-2-phenyl-5-[4-(pyridin-2-ylmethylsulfanyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 118350924) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[[1-(fluoromethyl)cyclopropyl]methoxy]-2-phenyl-5-[4-(pyridin-2-ylmethylsulfanyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-[[1-(fluoromethyl)cyclopropyl]methoxy]-2-phenyl-5-[4-(pyridin-2-ylmethylsulfanyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 118350924 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-[[1-(fluoromethyl)cyclopropyl]methoxy]-2-phenyl-5-[4-(pyridin-2-ylmethylsulfanyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(OCC2(CF)CC2)c(N2CCN(SCc3ccccn3)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C25H28FN5O2S/c26-18-25(9-10-25)19-33-23-22(16-28-31(24(23)32)21-7-2-1-3-8-21)29-12-14-30(15-13-29)34-17-20-6-4-5-11-27-20/h1-8,11,16H,9-10,12-15,17-19H2 |
| InChIKey | MVBHOLQCHHCQNF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|