C26H29F2IN4O2S — CID 118351020
2-(3,5-difluorophenyl)-4-(2,2-dimethylpropoxy)-5-[4-[(4-iodophenyl)methylsulfanyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 118351020) has the molecular formula C26H29F2IN4O2S and a molecular weight of 626.51 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4-(2,2-dimethylpropoxy)-5-[4-[(4-iodophenyl)methylsulfanyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-(3,5-difluorophenyl)-4-(2,2-dimethylpropoxy)-5-[4-[(4-iodophenyl)methylsulfanyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 118351020 |
| Molecular Formula | C26H29F2IN4O2S |
| Molecular Weight | 626.51 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4-(2,2-dimethylpropoxy)-5-[4-[(4-iodophenyl)methylsulfanyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | CC(C)(C)COc1c(N2CCN(SCc3ccc(I)cc3)CC2)cnn(-c2cc(F)cc(F)c2)c1=O |
| InChI | InChI=1S/C26H29F2IN4O2S/c1-26(2,3)17-35-24-23(15-30-33(25(24)34)22-13-19(27)12-20(28)14-22)31-8-10-32(11-9-31)36-16-18-4-6-21(29)7-5-18/h4-7,12-15H,8-11,16-17H2,1-3H3 |
| InChIKey | PWOUJCDJTSVIOB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|